C30H29FN6O5S — CID 142934014
N-[4-[[3-butyl-1-[(2-fluorophenyl)methyl]-2,6-dioxo-7H-purin-8-yl]methyl]phenyl]-2-methyl-5-nitrobenzenesulfinamide (PubChem CID 142934014) has the molecular formula C30H29FN6O5S and a molecular weight of 604.66 g/mol. Its IUPAC name is N-[4-[[3-butyl-1-[(2-fluorophenyl)methyl]-2,6-dioxo-7H-purin-8-yl]methyl]phenyl]-2-methyl-5-nitrobenzenesulfinamide.
| Compound Name | N-[4-[[3-butyl-1-[(2-fluorophenyl)methyl]-2,6-dioxo-7H-purin-8-yl]methyl]phenyl]-2-methyl-5-nitrobenzenesulfinamide |
|---|---|
| PubChem CID | 142934014 |
| Molecular Formula | C30H29FN6O5S |
| Molecular Weight | 604.66 g/mol |
| Exact Mass | 604.19 |
| IUPAC Name | N-[4-[[3-butyl-1-[(2-fluorophenyl)methyl]-2,6-dioxo-7H-purin-8-yl]methyl]phenyl]-2-methyl-5-nitrobenzenesulfinamide |
| SMILES | CCCCn1c(=O)n(Cc2ccccc2F)c(=O)c2[nH]c(Cc3ccc(NS(=O)c4cc([N+](=O)[O-])ccc4C)cc3)nc21 |
| InChI | InChI=1S/C30H29FN6O5S/c1-3-4-15-35-28-27(29(38)36(30(35)39)18-21-7-5-6-8-24(21)31)32-26(33-28)16-20-10-12-22(13-11-20)34-43(42)25-17-23(37(40)41)14-9-19(25)2/h5-14,17,34H,3-4,15-16,18H2,1-2H3,(H,32,33) |
| InChIKey | OGIVNHADGINAFP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.66 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|