C23H23N5O4 — CID 18449559
8-benzyl-3-[2-(3-nitrophenyl)ethyl]-1-propyl-7H-purine-2,6-dione (PubChem CID 18449559) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is 8-benzyl-3-[2-(3-nitrophenyl)ethyl]-1-propyl-7H-purine-2,6-dione.
| Compound Name | 8-benzyl-3-[2-(3-nitrophenyl)ethyl]-1-propyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 18449559 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 8-benzyl-3-[2-(3-nitrophenyl)ethyl]-1-propyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(Cc3ccccc3)nc2n(CCc2cccc([N+](=O)[O-])c2)c1=O |
| InChI | InChI=1S/C23H23N5O4/c1-2-12-27-22(29)20-21(25-19(24-20)15-16-7-4-3-5-8-16)26(23(27)30)13-11-17-9-6-10-18(14-17)28(31)32/h3-10,14H,2,11-13,15H2,1H3,(H,24,25) |
| InChIKey | BUORNFDHJWIWOF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|