C23H25N5O5S — CID 18449474
[3-[[3-[2-(4-aminophenyl)ethyl]-2,6-dioxo-1-propyl-7H-purin-8-yl]methyl]phenyl] hydrogen sulfite (PubChem CID 18449474) has the molecular formula C23H25N5O5S and a molecular weight of 483.55 g/mol. Its IUPAC name is [3-[[3-[2-(4-aminophenyl)ethyl]-2,6-dioxo-1-propyl-7H-purin-8-yl]methyl]phenyl] hydrogen sulfite.
| Compound Name | [3-[[3-[2-(4-aminophenyl)ethyl]-2,6-dioxo-1-propyl-7H-purin-8-yl]methyl]phenyl] hydrogen sulfite |
|---|---|
| PubChem CID | 18449474 |
| Molecular Formula | C23H25N5O5S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | [3-[[3-[2-(4-aminophenyl)ethyl]-2,6-dioxo-1-propyl-7H-purin-8-yl]methyl]phenyl] hydrogen sulfite |
| SMILES | CCCn1c(=O)c2[nH]c(Cc3cccc(OS(=O)O)c3)nc2n(CCc2ccc(N)cc2)c1=O |
| InChI | InChI=1S/C23H25N5O5S/c1-2-11-28-22(29)20-21(27(23(28)30)12-10-15-6-8-17(24)9-7-15)26-19(25-20)14-16-4-3-5-18(13-16)33-34(31)32/h3-9,13H,2,10-12,14,24H2,1H3,(H,25,26)(H,31,32) |
| InChIKey | FOORZFLRJRUKIF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 145.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|