C25H28N4O5S — CID 10435927
4-[4-(8-benzyl-2,6-dioxo-1-propyl-7H-purin-3-yl)butyl]benzenesulfonic acid (PubChem CID 10435927) has the molecular formula C25H28N4O5S and a molecular weight of 496.59 g/mol. Its IUPAC name is 4-[4-(8-benzyl-2,6-dioxo-1-propyl-7H-purin-3-yl)butyl]benzenesulfonic acid.
| Compound Name | 4-[4-(8-benzyl-2,6-dioxo-1-propyl-7H-purin-3-yl)butyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 10435927 |
| Molecular Formula | C25H28N4O5S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | 4-[4-(8-benzyl-2,6-dioxo-1-propyl-7H-purin-3-yl)butyl]benzenesulfonic acid |
| SMILES | CCCn1c(=O)c2[nH]c(Cc3ccccc3)nc2n(CCCCc2ccc(S(=O)(=O)O)cc2)c1=O |
| InChI | InChI=1S/C25H28N4O5S/c1-2-15-29-24(30)22-23(27-21(26-22)17-19-9-4-3-5-10-19)28(25(29)31)16-7-6-8-18-11-13-20(14-12-18)35(32,33)34/h3-5,9-14H,2,6-8,15-17H2,1H3,(H,26,27)(H,32,33,34) |
| InChIKey | AJGCEJSAUBROIR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|