C19H20N8O4 — CID 18449444
3-[2-(2-nitrophenyl)ethyl]-1-propyl-8-(1H-1,2,4-triazol-5-ylmethyl)-7H-purine-2,6-dione (PubChem CID 18449444) has the molecular formula C19H20N8O4 and a molecular weight of 424.42 g/mol. Its IUPAC name is 3-[2-(2-nitrophenyl)ethyl]-1-propyl-8-(1H-1,2,4-triazol-5-ylmethyl)-7H-purine-2,6-dione.
| Compound Name | 3-[2-(2-nitrophenyl)ethyl]-1-propyl-8-(1H-1,2,4-triazol-5-ylmethyl)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 18449444 |
| Molecular Formula | C19H20N8O4 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 3-[2-(2-nitrophenyl)ethyl]-1-propyl-8-(1H-1,2,4-triazol-5-ylmethyl)-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(Cc3ncn[nH]3)nc2n(CCc2ccccc2[N+](=O)[O-])c1=O |
| InChI | InChI=1S/C19H20N8O4/c1-2-8-26-18(28)16-17(23-15(22-16)10-14-20-11-21-24-14)25(19(26)29)9-7-12-5-3-4-6-13(12)27(30)31/h3-6,11H,2,7-10H2,1H3,(H,22,23)(H,20,21,24) |
| InChIKey | GFIGFDKHHJMPMU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 157.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|