C25H33N9O5 — CID 66996469
7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-3-[2-(2-nitrophenyl)ethyl]-1-propyl-8-(1H-1,2,4-triazol-5-ylmethyl)purine-2,6-dione (PubChem CID 66996469) has the molecular formula C25H33N9O5 and a molecular weight of 539.60 g/mol. Its IUPAC name is 7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-3-[2-(2-nitrophenyl)ethyl]-1-propyl-8-(1H-1,2,4-triazol-5-ylmethyl)purine-2,6-dione.
| Compound Name | 7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-3-[2-(2-nitrophenyl)ethyl]-1-propyl-8-(1H-1,2,4-triazol-5-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 66996469 |
| Molecular Formula | C25H33N9O5 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | 7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-3-[2-(2-nitrophenyl)ethyl]-1-propyl-8-(1H-1,2,4-triazol-5-ylmethyl)purine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(Cc3ncn[nH]3)n2CCN(CC)CCO)n(CCc2ccccc2[N+](=O)[O-])c1=O |
| InChI | InChI=1S/C25H33N9O5/c1-3-10-33-24(36)22-23(32(25(33)37)11-9-18-7-5-6-8-19(18)34(38)39)28-21(16-20-26-17-27-29-20)31(22)13-12-30(4-2)14-15-35/h5-8,17,35H,3-4,9-16H2,1-2H3,(H,26,27,29) |
| InChIKey | UNRIWMBBXVFLDL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 170.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|