C24H32N10O5 — CID 66995701
7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-3-[2-(4-nitrophenyl)ethyl]-1-propyl-8-(2H-tetrazol-5-ylmethyl)purine-2,6-dione (PubChem CID 66995701) has the molecular formula C24H32N10O5 and a molecular weight of 540.59 g/mol. Its IUPAC name is 7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-3-[2-(4-nitrophenyl)ethyl]-1-propyl-8-(2H-tetrazol-5-ylmethyl)purine-2,6-dione.
| Compound Name | 7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-3-[2-(4-nitrophenyl)ethyl]-1-propyl-8-(2H-tetrazol-5-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 66995701 |
| Molecular Formula | C24H32N10O5 |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | 7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-3-[2-(4-nitrophenyl)ethyl]-1-propyl-8-(2H-tetrazol-5-ylmethyl)purine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(Cc3nn[nH]n3)n2CCN(CC)CCO)n(CCc2ccc([N+](=O)[O-])cc2)c1=O |
| InChI | InChI=1S/C24H32N10O5/c1-3-10-33-23(36)21-22(32(24(33)37)11-9-17-5-7-18(8-6-17)34(38)39)25-20(16-19-26-28-29-27-19)31(21)13-12-30(4-2)14-15-35/h5-8,35H,3-4,9-16H2,1-2H3,(H,26,27,28,29) |
| InChIKey | BFGZGTQTPFJMGV-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 182.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|