C29H36N6O7S — CID 66996512
[4-[[7-[2-(ethylamino)ethyl]-3-[4-(4-nitrophenyl)butyl]-2,6-dioxo-1-propylpurin-8-yl]methyl]phenyl] hydrogen sulfite (PubChem CID 66996512) has the molecular formula C29H36N6O7S and a molecular weight of 612.71 g/mol. Its IUPAC name is [4-[[7-[2-(ethylamino)ethyl]-3-[4-(4-nitrophenyl)butyl]-2,6-dioxo-1-propylpurin-8-yl]methyl]phenyl] hydrogen sulfite.
| Compound Name | [4-[[7-[2-(ethylamino)ethyl]-3-[4-(4-nitrophenyl)butyl]-2,6-dioxo-1-propylpurin-8-yl]methyl]phenyl] hydrogen sulfite |
|---|---|
| PubChem CID | 66996512 |
| Molecular Formula | C29H36N6O7S |
| Molecular Weight | 612.71 g/mol |
| Exact Mass | 612.24 |
| IUPAC Name | [4-[[7-[2-(ethylamino)ethyl]-3-[4-(4-nitrophenyl)butyl]-2,6-dioxo-1-propylpurin-8-yl]methyl]phenyl] hydrogen sulfite |
| SMILES | CCCn1c(=O)c2c(nc(Cc3ccc(OS(=O)O)cc3)n2CCNCC)n(CCCCc2ccc([N+](=O)[O-])cc2)c1=O |
| InChI | InChI=1S/C29H36N6O7S/c1-3-17-34-28(36)26-27(33(29(34)37)18-6-5-7-21-8-12-23(13-9-21)35(38)39)31-25(32(26)19-16-30-4-2)20-22-10-14-24(15-11-22)42-43(40)41/h8-15,30H,3-7,16-20H2,1-2H3,(H,40,41) |
| InChIKey | NKJXQKZYHCIUNL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 163.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.71 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|