C29H36N6O5 — CID 66995909
8-benzyl-7-[2-(2-hydroxybutylamino)ethyl]-3-[2-(4-nitrophenyl)ethyl]-1-propylpurine-2,6-dione (PubChem CID 66995909) has the molecular formula C29H36N6O5 and a molecular weight of 548.64 g/mol. Its IUPAC name is 8-benzyl-7-[2-(2-hydroxybutylamino)ethyl]-3-[2-(4-nitrophenyl)ethyl]-1-propylpurine-2,6-dione.
| Compound Name | 8-benzyl-7-[2-(2-hydroxybutylamino)ethyl]-3-[2-(4-nitrophenyl)ethyl]-1-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 66995909 |
| Molecular Formula | C29H36N6O5 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 8-benzyl-7-[2-(2-hydroxybutylamino)ethyl]-3-[2-(4-nitrophenyl)ethyl]-1-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(Cc3ccccc3)n2CCNCC(O)CC)n(CCc2ccc([N+](=O)[O-])cc2)c1=O |
| InChI | InChI=1S/C29H36N6O5/c1-3-16-34-28(37)26-27(33(29(34)38)17-14-21-10-12-23(13-11-21)35(39)40)31-25(19-22-8-6-5-7-9-22)32(26)18-15-30-20-24(36)4-2/h5-13,24,30,36H,3-4,14-20H2,1-2H3 |
| InChIKey | IYEQUJROMVXYKU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 137.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|