C26H35FN8O4 — CID 66996437
3-[2-(2,4-diaminophenyl)ethyl]-8-[(5-fluoro-1,3-oxazol-2-yl)methyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-propylpurine-2,6-dione (PubChem CID 66996437) has the molecular formula C26H35FN8O4 and a molecular weight of 542.62 g/mol. Its IUPAC name is 3-[2-(2,4-diaminophenyl)ethyl]-8-[(5-fluoro-1,3-oxazol-2-yl)methyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-propylpurine-2,6-dione.
| Compound Name | 3-[2-(2,4-diaminophenyl)ethyl]-8-[(5-fluoro-1,3-oxazol-2-yl)methyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 66996437 |
| Molecular Formula | C26H35FN8O4 |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | 3-[2-(2,4-diaminophenyl)ethyl]-8-[(5-fluoro-1,3-oxazol-2-yl)methyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(Cc3ncc(F)o3)n2CCNCC(O)CC)n(CCc2ccc(N)cc2N)c1=O |
| InChI | InChI=1S/C26H35FN8O4/c1-3-9-35-25(37)23-24(34(26(35)38)10-7-16-5-6-17(28)12-19(16)29)32-21(13-22-31-15-20(27)39-22)33(23)11-8-30-14-18(36)4-2/h5-6,12,15,18,30,36H,3-4,7-11,13-14,28-29H2,1-2H3 |
| InChIKey | UQBBRLMWZSSTPU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 172.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|