C27H34FN7O3 — CID 66995902
3-[2-(2-fluorophenyl)ethyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-propyl-8-(pyrazin-2-ylmethyl)purine-2,6-dione (PubChem CID 66995902) has the molecular formula C27H34FN7O3 and a molecular weight of 523.61 g/mol. Its IUPAC name is 3-[2-(2-fluorophenyl)ethyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-propyl-8-(pyrazin-2-ylmethyl)purine-2,6-dione.
| Compound Name | 3-[2-(2-fluorophenyl)ethyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-propyl-8-(pyrazin-2-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 66995902 |
| Molecular Formula | C27H34FN7O3 |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | 3-[2-(2-fluorophenyl)ethyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-propyl-8-(pyrazin-2-ylmethyl)purine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(Cc3cnccn3)n2CCNCC(O)CC)n(CCc2ccccc2F)c1=O |
| InChI | InChI=1S/C27H34FN7O3/c1-3-13-35-26(37)24-25(34(27(35)38)14-9-19-7-5-6-8-22(19)28)32-23(16-20-17-29-10-11-31-20)33(24)15-12-30-18-21(36)4-2/h5-8,10-11,17,21,30,36H,3-4,9,12-16,18H2,1-2H3 |
| InChIKey | PDKFQSBATUANAS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|