C22H21FN5O3- — CID 87766991
3-[2-(4-fluorophenyl)ethyl]-7-oxido-1-propyl-8-(pyridin-2-ylmethyl)purine-2,6-dione (PubChem CID 87766991) has the molecular formula C22H21FN5O3- and a molecular weight of 422.44 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)ethyl]-7-oxido-1-propyl-8-(pyridin-2-ylmethyl)purine-2,6-dione.
| Compound Name | 3-[2-(4-fluorophenyl)ethyl]-7-oxido-1-propyl-8-(pyridin-2-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 87766991 |
| Molecular Formula | C22H21FN5O3- |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 3-[2-(4-fluorophenyl)ethyl]-7-oxido-1-propyl-8-(pyridin-2-ylmethyl)purine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(Cc3ccccn3)n2[O-])n(CCc2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C22H21FN5O3/c1-2-12-27-21(29)19-20(25-18(28(19)31)14-17-5-3-4-11-24-17)26(22(27)30)13-10-15-6-8-16(23)9-7-15/h3-9,11H,2,10,12-14H2,1H3/q-1 |
| InChIKey | JZGNVNLWQUHECS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 97.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|