C33H45N7O3 — CID 68998604
6-amino-N-[2-[2-[8-benzyl-7-[2-(ethylamino)ethyl]-2,6-dioxo-1-propylpurin-3-yl]ethyl]phenyl]hexanamide (PubChem CID 68998604) has the molecular formula C33H45N7O3 and a molecular weight of 587.77 g/mol. Its IUPAC name is 6-amino-N-[2-[2-[8-benzyl-7-[2-(ethylamino)ethyl]-2,6-dioxo-1-propylpurin-3-yl]ethyl]phenyl]hexanamide.
| Compound Name | 6-amino-N-[2-[2-[8-benzyl-7-[2-(ethylamino)ethyl]-2,6-dioxo-1-propylpurin-3-yl]ethyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 68998604 |
| Molecular Formula | C33H45N7O3 |
| Molecular Weight | 587.77 g/mol |
| Exact Mass | 587.36 |
| IUPAC Name | 6-amino-N-[2-[2-[8-benzyl-7-[2-(ethylamino)ethyl]-2,6-dioxo-1-propylpurin-3-yl]ethyl]phenyl]hexanamide |
| SMILES | CCCn1c(=O)c2c(nc(Cc3ccccc3)n2CCNCC)n(CCc2ccccc2NC(=O)CCCCCN)c1=O |
| InChI | InChI=1S/C33H45N7O3/c1-3-21-40-32(42)30-31(37-28(38(30)23-20-35-4-2)24-25-13-7-5-8-14-25)39(33(40)43)22-18-26-15-10-11-16-27(26)36-29(41)17-9-6-12-19-34/h5,7-8,10-11,13-16,35H,3-4,6,9,12,17-24,34H2,1-2H3,(H,36,41) |
| InChIKey | YOMHVNKKWPQGQJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.77 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|