C30H40N6O3 — CID 66996432
3-[2-(4-aminophenyl)ethyl]-8-benzyl-1-butyl-7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]purine-2,6-dione (PubChem CID 66996432) has the molecular formula C30H40N6O3 and a molecular weight of 532.69 g/mol. Its IUPAC name is 3-[2-(4-aminophenyl)ethyl]-8-benzyl-1-butyl-7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]purine-2,6-dione.
| Compound Name | 3-[2-(4-aminophenyl)ethyl]-8-benzyl-1-butyl-7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 66996432 |
| Molecular Formula | C30H40N6O3 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | 3-[2-(4-aminophenyl)ethyl]-8-benzyl-1-butyl-7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]purine-2,6-dione |
| SMILES | CCCCn1c(=O)c2c(nc(Cc3ccccc3)n2CCN(CC)CCO)n(CCc2ccc(N)cc2)c1=O |
| InChI | InChI=1S/C30H40N6O3/c1-3-5-16-36-29(38)27-28(35(30(36)39)17-15-23-11-13-25(31)14-12-23)32-26(22-24-9-7-6-8-10-24)34(27)19-18-33(4-2)20-21-37/h6-14,37H,3-5,15-22,31H2,1-2H3 |
| InChIKey | YQTWUMBWPVWPQS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|