C30H38N6O6 — CID 66995737
8-benzyl-7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-1-(3-methoxypropyl)-3-[2-(4-nitrophenyl)ethyl]purine-2,6-dione (PubChem CID 66995737) has the molecular formula C30H38N6O6 and a molecular weight of 578.67 g/mol. Its IUPAC name is 8-benzyl-7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-1-(3-methoxypropyl)-3-[2-(4-nitrophenyl)ethyl]purine-2,6-dione.
| Compound Name | 8-benzyl-7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-1-(3-methoxypropyl)-3-[2-(4-nitrophenyl)ethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 66995737 |
| Molecular Formula | C30H38N6O6 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | 8-benzyl-7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-1-(3-methoxypropyl)-3-[2-(4-nitrophenyl)ethyl]purine-2,6-dione |
| SMILES | CCN(CCO)CCn1c(Cc2ccccc2)nc2c1c(=O)n(CCCOC)c(=O)n2CCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H38N6O6/c1-3-32(19-20-37)17-18-33-26(22-24-8-5-4-6-9-24)31-28-27(33)29(38)35(15-7-21-42-2)30(39)34(28)16-14-23-10-12-25(13-11-23)36(40)41/h4-6,8-13,37H,3,7,14-22H2,1-2H3 |
| InChIKey | VRBCPNSWEDJRJJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 137.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|