C26H35N7O4 — CID 66996435
3-[2-(4-aminophenyl)ethyl]-7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-8-(1,3-oxazol-2-ylmethyl)-1-propylpurine-2,6-dione (PubChem CID 66996435) has the molecular formula C26H35N7O4 and a molecular weight of 509.61 g/mol. Its IUPAC name is 3-[2-(4-aminophenyl)ethyl]-7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-8-(1,3-oxazol-2-ylmethyl)-1-propylpurine-2,6-dione.
| Compound Name | 3-[2-(4-aminophenyl)ethyl]-7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-8-(1,3-oxazol-2-ylmethyl)-1-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 66996435 |
| Molecular Formula | C26H35N7O4 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | 3-[2-(4-aminophenyl)ethyl]-7-[2-[ethyl(2-hydroxyethyl)amino]ethyl]-8-(1,3-oxazol-2-ylmethyl)-1-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(Cc3ncco3)n2CCN(CC)CCO)n(CCc2ccc(N)cc2)c1=O |
| InChI | InChI=1S/C26H35N7O4/c1-3-11-33-25(35)23-24(32(26(33)36)12-9-19-5-7-20(27)8-6-19)29-21(18-22-28-10-17-37-22)31(23)14-13-30(4-2)15-16-34/h5-8,10,17,34H,3-4,9,11-16,18,27H2,1-2H3 |
| InChIKey | FINVIYHXMODGEB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 137.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|