C23H35N5O3Si — CID 600120
8-benzyl-7-[2-[ethyl(2-trimethylsilyloxyethyl)amino]ethyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 600120) has the molecular formula C23H35N5O3Si and a molecular weight of 457.65 g/mol. Its IUPAC name is 8-benzyl-7-[2-[ethyl(2-trimethylsilyloxyethyl)amino]ethyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-benzyl-7-[2-[ethyl(2-trimethylsilyloxyethyl)amino]ethyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 600120 |
| Molecular Formula | C23H35N5O3Si |
| Molecular Weight | 457.65 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 8-benzyl-7-[2-[ethyl(2-trimethylsilyloxyethyl)amino]ethyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | CCN(CCO[Si](C)(C)C)CCn1c(Cc2ccccc2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C23H35N5O3Si/c1-7-27(15-16-31-32(4,5)6)13-14-28-19(17-18-11-9-8-10-12-18)24-21-20(28)22(29)26(3)23(30)25(21)2/h8-12H,7,13-17H2,1-6H3 |
| InChIKey | HUEVSUWKGHXSHI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 74.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.65 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|