C30H39N5O2 — CID 5026553
8-[(dibenzylamino)methyl]-1,3-dimethyl-7-octylpurine-2,6-dione (PubChem CID 5026553) has the molecular formula C30H39N5O2 and a molecular weight of 501.68 g/mol. Its IUPAC name is 8-[(dibenzylamino)methyl]-1,3-dimethyl-7-octylpurine-2,6-dione.
| Compound Name | 8-[(dibenzylamino)methyl]-1,3-dimethyl-7-octylpurine-2,6-dione |
|---|---|
| PubChem CID | 5026553 |
| Molecular Formula | C30H39N5O2 |
| Molecular Weight | 501.68 g/mol |
| Exact Mass | 501.31 |
| IUPAC Name | 8-[(dibenzylamino)methyl]-1,3-dimethyl-7-octylpurine-2,6-dione |
| SMILES | CCCCCCCCn1c(CN(Cc2ccccc2)Cc2ccccc2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C30H39N5O2/c1-4-5-6-7-8-15-20-35-26(31-28-27(35)29(36)33(3)30(37)32(28)2)23-34(21-24-16-11-9-12-17-24)22-25-18-13-10-14-19-25/h9-14,16-19H,4-8,15,20-23H2,1-3H3 |
| InChIKey | DQQGGCJXUQNJFK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 65.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.68 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|