C20H33N5O3 — CID 4310898
1,3-dimethyl-8-(morpholin-4-ylmethyl)-7-octylpurine-2,6-dione (PubChem CID 4310898) has the molecular formula C20H33N5O3 and a molecular weight of 391.52 g/mol. Its IUPAC name is 1,3-dimethyl-8-(morpholin-4-ylmethyl)-7-octylpurine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-(morpholin-4-ylmethyl)-7-octylpurine-2,6-dione |
|---|---|
| PubChem CID | 4310898 |
| Molecular Formula | C20H33N5O3 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | 1,3-dimethyl-8-(morpholin-4-ylmethyl)-7-octylpurine-2,6-dione |
| SMILES | CCCCCCCCn1c(CN2CCOCC2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C20H33N5O3/c1-4-5-6-7-8-9-10-25-16(15-24-11-13-28-14-12-24)21-18-17(25)19(26)23(3)20(27)22(18)2/h4-15H2,1-3H3 |
| InChIKey | YDCAFHPAHXVHQE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 74.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|