C31H42N6O3 — CID 11318783
8-[(3-aminophenyl)methyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-pentyl-3-(2-phenylethyl)purine-2,6-dione (PubChem CID 11318783) has the molecular formula C31H42N6O3 and a molecular weight of 546.72 g/mol. Its IUPAC name is 8-[(3-aminophenyl)methyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-pentyl-3-(2-phenylethyl)purine-2,6-dione.
| Compound Name | 8-[(3-aminophenyl)methyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-pentyl-3-(2-phenylethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 11318783 |
| Molecular Formula | C31H42N6O3 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | 8-[(3-aminophenyl)methyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-pentyl-3-(2-phenylethyl)purine-2,6-dione |
| SMILES | CCCCCn1c(=O)c2c(nc(Cc3cccc(N)c3)n2CCNCC(O)CC)n(CCc2ccccc2)c1=O |
| InChI | InChI=1S/C31H42N6O3/c1-3-5-9-17-37-30(39)28-29(36(31(37)40)18-15-23-11-7-6-8-12-23)34-27(21-24-13-10-14-25(32)20-24)35(28)19-16-33-22-26(38)4-2/h6-8,10-14,20,26,33,38H,3-5,9,15-19,21-22,32H2,1-2H3 |
| InChIKey | DDHMYCYZLQNQPS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 120.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|