C39H54N8O7 — CID 91070317
4-[3-amino-4-[2-[8-benzyl-7-[2-(2-hydroxybutylamino)ethyl]-2,6-dioxo-1-propylpurin-3-yl]ethyl]phenyl]-3-(6-aminohexanoylamino)-4-oxobutanoic acid (PubChem CID 91070317) has the molecular formula C39H54N8O7 and a molecular weight of 746.91 g/mol. Its IUPAC name is 4-[3-amino-4-[2-[8-benzyl-7-[2-(2-hydroxybutylamino)ethyl]-2,6-dioxo-1-propylpurin-3-yl]ethyl]phenyl]-3-(6-aminohexanoylamino)-4-oxobutanoic acid.
| Compound Name | 4-[3-amino-4-[2-[8-benzyl-7-[2-(2-hydroxybutylamino)ethyl]-2,6-dioxo-1-propylpurin-3-yl]ethyl]phenyl]-3-(6-aminohexanoylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 91070317 |
| Molecular Formula | C39H54N8O7 |
| Molecular Weight | 746.91 g/mol |
| Exact Mass | 746.41 |
| IUPAC Name | 4-[3-amino-4-[2-[8-benzyl-7-[2-(2-hydroxybutylamino)ethyl]-2,6-dioxo-1-propylpurin-3-yl]ethyl]phenyl]-3-(6-aminohexanoylamino)-4-oxobutanoic acid |
| SMILES | CCCn1c(=O)c2c(nc(Cc3ccccc3)n2CCNCC(O)CC)n(CCc2ccc(C(=O)C(CC(=O)O)NC(=O)CCCCCN)cc2N)c1=O |
| InChI | InChI=1S/C39H54N8O7/c1-3-19-47-38(53)35-37(44-32(22-26-11-7-5-8-12-26)45(35)21-18-42-25-29(48)4-2)46(39(47)54)20-16-27-14-15-28(23-30(27)41)36(52)31(24-34(50)51)43-33(49)13-9-6-10-17-40/h5,7-8,11-12,14-15,23,29,31,42,48H,3-4,6,9-10,13,16-22,24-25,40-41H2,1-2H3,(H,43,49)(H,50,51) |
| InChIKey | UFUDQZHGOIHZSN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 229.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.91 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|