C26H34FN7O3S — CID 66995870
3-[2-(2-aminophenyl)ethyl]-8-[(4-fluoro-1,2-thiazol-3-yl)methyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-propylpurine-2,6-dione (PubChem CID 66995870) has the molecular formula C26H34FN7O3S and a molecular weight of 543.67 g/mol. Its IUPAC name is 3-[2-(2-aminophenyl)ethyl]-8-[(4-fluoro-1,2-thiazol-3-yl)methyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-propylpurine-2,6-dione.
| Compound Name | 3-[2-(2-aminophenyl)ethyl]-8-[(4-fluoro-1,2-thiazol-3-yl)methyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 66995870 |
| Molecular Formula | C26H34FN7O3S |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | 3-[2-(2-aminophenyl)ethyl]-8-[(4-fluoro-1,2-thiazol-3-yl)methyl]-7-[2-(2-hydroxybutylamino)ethyl]-1-propylpurine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(Cc3nscc3F)n2CCNCC(O)CC)n(CCc2ccccc2N)c1=O |
| InChI | InChI=1S/C26H34FN7O3S/c1-3-11-34-25(36)23-24(33(26(34)37)12-9-17-7-5-6-8-20(17)28)30-22(14-21-19(27)16-38-31-21)32(23)13-10-29-15-18(35)4-2/h5-8,16,18,29,35H,3-4,9-15,28H2,1-2H3 |
| InChIKey | FEDNSUQRQYEJQS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 132.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|