C26H36N6O3S — CID 66996348
8-benzyl-7-[2-(2-hydroxybutylamino)ethyl]-1-propyl-3-[2-(2H-1,3-thiazol-3-yl)ethyl]purine-2,6-dione (PubChem CID 66996348) has the molecular formula C26H36N6O3S and a molecular weight of 512.68 g/mol. Its IUPAC name is 8-benzyl-7-[2-(2-hydroxybutylamino)ethyl]-1-propyl-3-[2-(2H-1,3-thiazol-3-yl)ethyl]purine-2,6-dione.
| Compound Name | 8-benzyl-7-[2-(2-hydroxybutylamino)ethyl]-1-propyl-3-[2-(2H-1,3-thiazol-3-yl)ethyl]purine-2,6-dione |
|---|---|
| PubChem CID | 66996348 |
| Molecular Formula | C26H36N6O3S |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | 8-benzyl-7-[2-(2-hydroxybutylamino)ethyl]-1-propyl-3-[2-(2H-1,3-thiazol-3-yl)ethyl]purine-2,6-dione |
| SMILES | CCCn1c(=O)c2c(nc(Cc3ccccc3)n2CCNCC(O)CC)n(CCN2C=CSC2)c1=O |
| InChI | InChI=1S/C26H36N6O3S/c1-3-11-32-25(34)23-24(31(26(32)35)14-13-29-15-16-36-19-29)28-22(17-20-8-6-5-7-9-20)30(23)12-10-27-18-21(33)4-2/h5-9,15-16,21,27,33H,3-4,10-14,17-19H2,1-2H3 |
| InChIKey | MDSWOMZRPBGFOT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|