C23H25N5O8S — CID 45118834
(4-nitrophenyl) 4-[(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)carbamoyl]benzenesulfonate (PubChem CID 45118834) has the molecular formula C23H25N5O8S and a molecular weight of 531.55 g/mol. Its IUPAC name is (4-nitrophenyl) 4-[(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)carbamoyl]benzenesulfonate.
| Compound Name | (4-nitrophenyl) 4-[(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)carbamoyl]benzenesulfonate |
|---|---|
| PubChem CID | 45118834 |
| Molecular Formula | C23H25N5O8S |
| Molecular Weight | 531.55 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | (4-nitrophenyl) 4-[(4-amino-2,6-dioxo-1,3-dipropylpyrimidin-5-yl)carbamoyl]benzenesulfonate |
| SMILES | CCCn1c(N)c(NC(=O)c2ccc(S(=O)(=O)Oc3ccc([N+](=O)[O-])cc3)cc2)c(=O)n(CCC)c1=O |
| InChI | InChI=1S/C23H25N5O8S/c1-3-13-26-20(24)19(22(30)27(14-4-2)23(26)31)25-21(29)15-5-11-18(12-6-15)37(34,35)36-17-9-7-16(8-10-17)28(32)33/h5-12H,3-4,13-14,24H2,1-2H3,(H,25,29) |
| InChIKey | GWUMMULBPBBTIB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 185.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.55 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|