C27H34N4O10 — CID 172872060
N-ethyl-2-[2-[[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)phenyl]methyl]-5-nitrobenzimidazol-1-yl]ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 172872060) has the molecular formula C27H34N4O10 and a molecular weight of 581.63 g/mol. Its IUPAC name is N-ethyl-2-[2-[[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)phenyl]methyl]-5-nitrobenzimidazol-1-yl]ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | N-ethyl-2-[2-[[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)phenyl]methyl]-5-nitrobenzimidazol-1-yl]ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 172872060 |
| Molecular Formula | C27H34N4O10 |
| Molecular Weight | 581.63 g/mol |
| Exact Mass | 581.27 |
| IUPAC Name | N-ethyl-2-[2-[[4-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yloxy)phenyl]methyl]-5-nitrobenzimidazol-1-yl]ethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.[2H]C([2H])([2H])C([2H])(Oc1ccc(Cc2nc3cc([N+](=O)[O-])ccc3n2CCNCC)cc1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C21H26N4O3.C6H8O7/c1-4-22-11-12-24-20-10-7-17(25(26)27)14-19(20)23-21(24)13-16-5-8-18(9-6-16)28-15(2)3;7-3(8)1-6(13,5(11)12)2-4(9)10/h5-10,14-15,22H,4,11-13H2,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/i2D3,3D3,15D; |
| InChIKey | IJPSHSNVNZEODA-LDJSNABQSA-N |
| XLogP | 2.68 |
| TPSA | 214.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.63 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|