C28H38N6O5S — CID 178134639
N-[1-[[4-[[1-[2-(diethylamino)ethyl]-5-nitrobenzimidazol-2-yl]methyl]phenoxy]-methylamino]ethyl]-N-methyl-4-oxo-2-sulfanylbutanamide (PubChem CID 178134639) has the molecular formula C28H38N6O5S and a molecular weight of 570.72 g/mol. Its IUPAC name is N-[1-[[4-[[1-[2-(diethylamino)ethyl]-5-nitrobenzimidazol-2-yl]methyl]phenoxy]-methylamino]ethyl]-N-methyl-4-oxo-2-sulfanylbutanamide.
| Compound Name | N-[1-[[4-[[1-[2-(diethylamino)ethyl]-5-nitrobenzimidazol-2-yl]methyl]phenoxy]-methylamino]ethyl]-N-methyl-4-oxo-2-sulfanylbutanamide |
|---|---|
| PubChem CID | 178134639 |
| Molecular Formula | C28H38N6O5S |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | N-[1-[[4-[[1-[2-(diethylamino)ethyl]-5-nitrobenzimidazol-2-yl]methyl]phenoxy]-methylamino]ethyl]-N-methyl-4-oxo-2-sulfanylbutanamide |
| SMILES | CCN(CC)CCn1c(Cc2ccc(ON(C)C(C)N(C)C(=O)C(S)CC=O)cc2)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C28H38N6O5S/c1-6-32(7-2)15-16-33-25-13-10-22(34(37)38)19-24(25)29-27(33)18-21-8-11-23(12-9-21)39-31(5)20(3)30(4)28(36)26(40)14-17-35/h8-13,17,19-20,26,40H,6-7,14-16,18H2,1-5H3 |
| InChIKey | BBMNBPRULKBYLN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|