C19H30ClN5O3 — CID 29791
N,N-diethyl-2-[2-(2-morpholin-4-ium-4-ylethyl)-5-nitrobenzimidazol-1-yl]ethanamine chloride (PubChem CID 29791) has the molecular formula C19H30ClN5O3 and a molecular weight of 411.93 g/mol. Its IUPAC name is N,N-diethyl-2-[2-(2-morpholin-4-ium-4-ylethyl)-5-nitrobenzimidazol-1-yl]ethanamine chloride.
| Compound Name | N,N-diethyl-2-[2-(2-morpholin-4-ium-4-ylethyl)-5-nitrobenzimidazol-1-yl]ethanamine chloride |
|---|---|
| PubChem CID | 29791 |
| Molecular Formula | C19H30ClN5O3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | N,N-diethyl-2-[2-(2-morpholin-4-ium-4-ylethyl)-5-nitrobenzimidazol-1-yl]ethanamine chloride |
| SMILES | CCN(CC)CCn1c(CC[NH+]2CCOCC2)nc2cc([N+](=O)[O-])ccc21.[Cl-] |
| InChI | InChI=1S/C19H29N5O3.ClH/c1-3-21(4-2)9-10-23-18-6-5-16(24(25)26)15-17(18)20-19(23)7-8-22-11-13-27-14-12-22;/h5-6,15H,3-4,7-14H2,1-2H3;1H |
| InChIKey | GPWJRDWBQGTQHP-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 77.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|