C21H26N4O2 — CID 15327525
N,N-diethyl-2-[5-nitro-2-(2-phenylethyl)benzimidazol-1-yl]ethanamine (PubChem CID 15327525) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is N,N-diethyl-2-[5-nitro-2-(2-phenylethyl)benzimidazol-1-yl]ethanamine.
| Compound Name | N,N-diethyl-2-[5-nitro-2-(2-phenylethyl)benzimidazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 15327525 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | N,N-diethyl-2-[5-nitro-2-(2-phenylethyl)benzimidazol-1-yl]ethanamine |
| SMILES | CCN(CC)CCn1c(CCc2ccccc2)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C21H26N4O2/c1-3-23(4-2)14-15-24-20-12-11-18(25(26)27)16-19(20)22-21(24)13-10-17-8-6-5-7-9-17/h5-9,11-12,16H,3-4,10,13-15H2,1-2H3 |
| InChIKey | CFBUHHXDOWWVJW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|