C24H31N5O4 — CID 178134631
5-[ethyl-[2-[2-[(4-methoxyphenyl)methyl]-5-nitrobenzimidazol-1-yl]ethyl]amino]pentanamide (PubChem CID 178134631) has the molecular formula C24H31N5O4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 5-[ethyl-[2-[2-[(4-methoxyphenyl)methyl]-5-nitrobenzimidazol-1-yl]ethyl]amino]pentanamide.
| Compound Name | 5-[ethyl-[2-[2-[(4-methoxyphenyl)methyl]-5-nitrobenzimidazol-1-yl]ethyl]amino]pentanamide |
|---|---|
| PubChem CID | 178134631 |
| Molecular Formula | C24H31N5O4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 5-[ethyl-[2-[2-[(4-methoxyphenyl)methyl]-5-nitrobenzimidazol-1-yl]ethyl]amino]pentanamide |
| SMILES | CCN(CCCCC(N)=O)CCn1c(Cc2ccc(OC)cc2)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C24H31N5O4/c1-3-27(13-5-4-6-23(25)30)14-15-28-22-12-9-19(29(31)32)17-21(22)26-24(28)16-18-7-10-20(33-2)11-8-18/h7-12,17H,3-6,13-16H2,1-2H3,(H2,25,30) |
| InChIKey | JRXQGRZGPFTNPZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 116.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|