C29H41N5O4 — CID 178134637
5-[4-[[1-[2-(diethylamino)ethyl]-5-nitrobenzimidazol-2-yl]methyl]phenoxy]-2,2,4,4-tetramethylpentanamide (PubChem CID 178134637) has the molecular formula C29H41N5O4 and a molecular weight of 523.68 g/mol. Its IUPAC name is 5-[4-[[1-[2-(diethylamino)ethyl]-5-nitrobenzimidazol-2-yl]methyl]phenoxy]-2,2,4,4-tetramethylpentanamide.
| Compound Name | 5-[4-[[1-[2-(diethylamino)ethyl]-5-nitrobenzimidazol-2-yl]methyl]phenoxy]-2,2,4,4-tetramethylpentanamide |
|---|---|
| PubChem CID | 178134637 |
| Molecular Formula | C29H41N5O4 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.32 |
| IUPAC Name | 5-[4-[[1-[2-(diethylamino)ethyl]-5-nitrobenzimidazol-2-yl]methyl]phenoxy]-2,2,4,4-tetramethylpentanamide |
| SMILES | CCN(CC)CCn1c(Cc2ccc(OCC(C)(C)CC(C)(C)C(N)=O)cc2)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C29H41N5O4/c1-7-32(8-2)15-16-33-25-14-11-22(34(36)37)18-24(25)31-26(33)17-21-9-12-23(13-10-21)38-20-28(3,4)19-29(5,6)27(30)35/h9-14,18H,7-8,15-17,19-20H2,1-6H3,(H2,30,35) |
| InChIKey | MGVRGCFRNZMJSM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 116.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|