C15H20N4O2 — CID 59057360
1,3-bis(cyclopropylmethyl)-7,8-dimethylpurine-2,6-dione (PubChem CID 59057360) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 1,3-bis(cyclopropylmethyl)-7,8-dimethylpurine-2,6-dione.
| Compound Name | 1,3-bis(cyclopropylmethyl)-7,8-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 59057360 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1,3-bis(cyclopropylmethyl)-7,8-dimethylpurine-2,6-dione |
| SMILES | Cc1nc2c(c(=O)n(CC3CC3)c(=O)n2CC2CC2)n1C |
| InChI | InChI=1S/C15H20N4O2/c1-9-16-13-12(17(9)2)14(20)19(8-11-5-6-11)15(21)18(13)7-10-3-4-10/h10-11H,3-8H2,1-2H3 |
| InChIKey | IZUDSLQUHPVMFF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |