C11H13ClN4O2 — CID 153298083
8-chloro-1-(cyclopropylmethyl)-3,7-dimethylpurine-2,6-dione (PubChem CID 153298083) has the molecular formula C11H13ClN4O2 and a molecular weight of 268.70 g/mol. Its IUPAC name is 8-chloro-1-(cyclopropylmethyl)-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-chloro-1-(cyclopropylmethyl)-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 153298083 |
| Molecular Formula | C11H13ClN4O2 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 8-chloro-1-(cyclopropylmethyl)-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(Cl)nc2c1c(=O)n(CC1CC1)c(=O)n2C |
| InChI | InChI=1S/C11H13ClN4O2/c1-14-7-8(13-10(14)12)15(2)11(18)16(9(7)17)5-6-3-4-6/h6H,3-5H2,1-2H3 |
| InChIKey | VRBCGMMITUCIBQ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |