C14H18N4O4 — CID 145301426
3,7,8-trimethyl-1-[(5-oxooxan-2-yl)methyl]purine-2,6-dione (PubChem CID 145301426) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is 3,7,8-trimethyl-1-[(5-oxooxan-2-yl)methyl]purine-2,6-dione.
| Compound Name | 3,7,8-trimethyl-1-[(5-oxooxan-2-yl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 145301426 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 3,7,8-trimethyl-1-[(5-oxooxan-2-yl)methyl]purine-2,6-dione |
| SMILES | Cc1nc2c(c(=O)n(CC3CCC(=O)CO3)c(=O)n2C)n1C |
| InChI | InChI=1S/C14H18N4O4/c1-8-15-12-11(16(8)2)13(20)18(14(21)17(12)3)6-10-5-4-9(19)7-22-10/h10H,4-7H2,1-3H3 |
| InChIKey | LMXMCPSDWLIMTM-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 88.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |