C10H11ClN4O2 — CID 166290964
8-chloro-1-(cyclopropylmethyl)-3-methyl-7H-purine-2,6-dione (PubChem CID 166290964) has the molecular formula C10H11ClN4O2 and a molecular weight of 254.68 g/mol. Its IUPAC name is 8-chloro-1-(cyclopropylmethyl)-3-methyl-7H-purine-2,6-dione.
| Compound Name | 8-chloro-1-(cyclopropylmethyl)-3-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 166290964 |
| Molecular Formula | C10H11ClN4O2 |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 8-chloro-1-(cyclopropylmethyl)-3-methyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)n(CC2CC2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C10H11ClN4O2/c1-14-7-6(12-9(11)13-7)8(16)15(10(14)17)4-5-2-3-5/h5H,2-4H2,1H3,(H,12,13) |
| InChIKey | DCHCOVMXKGJFAV-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |