About 8-chloro-1-(cyclopropylmethyl)-3-methyl-7H-purine-2,6-dione
8-chloro-1-(cyclopropylmethyl)-3-methyl-7H-purine-2,6-dione (PubChem CID 166290964) has the molecular formula C10H11ClN4O2
and a molecular weight of 254.68 g/mol. Its IUPAC name is 8-chloro-1-(cyclopropylmethyl)-3-methyl-7H-purine-2,6-dione.
Molecular Properties
| Compound Name | 8-chloro-1-(cyclopropylmethyl)-3-methyl-7H-purine-2,6-dione |
| PubChem CID | 166290964 |
| Molecular Formula | C10H11ClN4O2 |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 8-chloro-1-(cyclopropylmethyl)-3-methyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)n(CC2CC2)c(=O)c2[nH]c(Cl)nc21 |
| InChI | InChI=1S/C10H11ClN4O2/c1-14-7-6(12-9(11)13-7)8(16)15(10(14)17)4-5-2-3-5/h5H,2-4H2,1H3,(H,12,13) |
| InChIKey | DCHCOVMXKGJFAV-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-chloro-1-(cyclopropylmethyl)-3-methyl-7H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-1-(cyclopropylmethyl)-3-methyl-7H-purine-2,6-dione?
The IUPAC name of 8-chloro-1-(cyclopropylmethyl)-3-methyl-7H-purine-2,6-dione (CID 166290964) is 8-chloro-1-(cyclopropylmethyl)-3-methyl-7H-purine-2,6-dione.
What is the SMILES notation for 8-chloro-1-(cyclopropylmethyl)-3-methyl-7H-purine-2,6-dione?
The canonical SMILES for 8-chloro-1-(cyclopropylmethyl)-3-methyl-7H-purine-2,6-dione is Cn1c(=O)n(CC2CC2)c(=O)c2[nH]c(Cl)nc21.
What is the InChIKey of 8-chloro-1-(cyclopropylmethyl)-3-methyl-7H-purine-2,6-dione?
The InChIKey is DCHCOVMXKGJFAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN4O2/c1-14-7-6(12-9(11)13-7)8(16)15(10(14)17)4-5-2-3-5/h5H,2-4H2,1H3,(H,12,13).
What are the key properties of 8-chloro-1-(cyclopropylmethyl)-3-methyl-7H-purine-2,6-dione?
8-chloro-1-(cyclopropylmethyl)-3-methyl-7H-purine-2,6-dione has a molecular weight of 254.68 g/mol, XLogP of 0.49, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-1-(cyclopropylmethyl)-3-methyl-7H-purine-2,6-dione is sourced from PubChem (CID 166290964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).