About 8-amino-1,3-bis(cyclopropylmethyl)-7-methylpurine-2,6-dione
8-amino-1,3-bis(cyclopropylmethyl)-7-methylpurine-2,6-dione (PubChem CID 10039809) has the molecular formula C14H19N5O2
and a molecular weight of 289.34 g/mol. Its IUPAC name is 8-amino-1,3-bis(cyclopropylmethyl)-7-methylpurine-2,6-dione.
Molecular Properties
| Compound Name | 8-amino-1,3-bis(cyclopropylmethyl)-7-methylpurine-2,6-dione |
| PubChem CID | 10039809 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 8-amino-1,3-bis(cyclopropylmethyl)-7-methylpurine-2,6-dione |
| SMILES | Cn1c(N)nc2c1c(=O)n(CC1CC1)c(=O)n2CC1CC1 |
| InChI | InChI=1S/C14H19N5O2/c1-17-10-11(16-13(17)15)18(6-8-2-3-8)14(21)19(12(10)20)7-9-4-5-9/h8-9H,2-7H2,1H3,(H2,15,16) |
| InChIKey | OWVIGDPBXAJOAS-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 8-amino-1,3-bis(cyclopropylmethyl)-7-methylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-1,3-bis(cyclopropylmethyl)-7-methylpurine-2,6-dione?
The IUPAC name of 8-amino-1,3-bis(cyclopropylmethyl)-7-methylpurine-2,6-dione (CID 10039809) is 8-amino-1,3-bis(cyclopropylmethyl)-7-methylpurine-2,6-dione.
What is the SMILES notation for 8-amino-1,3-bis(cyclopropylmethyl)-7-methylpurine-2,6-dione?
The canonical SMILES for 8-amino-1,3-bis(cyclopropylmethyl)-7-methylpurine-2,6-dione is Cn1c(N)nc2c1c(=O)n(CC1CC1)c(=O)n2CC1CC1.
What is the InChIKey of 8-amino-1,3-bis(cyclopropylmethyl)-7-methylpurine-2,6-dione?
The InChIKey is OWVIGDPBXAJOAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5O2/c1-17-10-11(16-13(17)15)18(6-8-2-3-8)14(21)19(12(10)20)7-9-4-5-9/h8-9H,2-7H2,1H3,(H2,15,16).
What are the key properties of 8-amino-1,3-bis(cyclopropylmethyl)-7-methylpurine-2,6-dione?
8-amino-1,3-bis(cyclopropylmethyl)-7-methylpurine-2,6-dione has a molecular weight of 289.34 g/mol, XLogP of 0.30, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-1,3-bis(cyclopropylmethyl)-7-methylpurine-2,6-dione is sourced from PubChem (CID 10039809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).