C12H19N5O3 — CID 82465130
8-amino-1-ethyl-3-(3-methoxypropyl)-7-methylpurine-2,6-dione (PubChem CID 82465130) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is 8-amino-1-ethyl-3-(3-methoxypropyl)-7-methylpurine-2,6-dione.
| Compound Name | 8-amino-1-ethyl-3-(3-methoxypropyl)-7-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 82465130 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 8-amino-1-ethyl-3-(3-methoxypropyl)-7-methylpurine-2,6-dione |
| SMILES | CCn1c(=O)c2c(nc(N)n2C)n(CCCOC)c1=O |
| InChI | InChI=1S/C12H19N5O3/c1-4-16-10(18)8-9(14-11(13)15(8)2)17(12(16)19)6-5-7-20-3/h4-7H2,1-3H3,(H2,13,14) |
| InChIKey | FGEIBDDIOJLXGU-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|