C16H22N4O3 — CID 11885629
(6S)-2-ethyl-6-(3-methoxypropyl)-4,7-dimethyl-6H-purino[7,8-a]pyrrole-1,3-dione (PubChem CID 11885629) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is (6S)-2-ethyl-6-(3-methoxypropyl)-4,7-dimethyl-6H-purino[7,8-a]pyrrole-1,3-dione.
| Compound Name | (6S)-2-ethyl-6-(3-methoxypropyl)-4,7-dimethyl-6H-purino[7,8-a]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 11885629 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (6S)-2-ethyl-6-(3-methoxypropyl)-4,7-dimethyl-6H-purino[7,8-a]pyrrole-1,3-dione |
| SMILES | CCn1c(=O)c2c(nc3n2C=C(C)[C@@H]3CCCOC)n(C)c1=O |
| InChI | InChI=1S/C16H22N4O3/c1-5-19-15(21)12-14(18(3)16(19)22)17-13-11(7-6-8-23-4)10(2)9-20(12)13/h9,11H,5-8H2,1-4H3/t11-/m0/s1 |
| InChIKey | LZEZUKOFYOIPHM-NSHDSACASA-N |
| XLogP | 1.30 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|