C10H11F3N4O2 — CID 86292478
1-ethyl-3,7-dimethyl-8-(trifluoromethyl)purine-2,6-dione (PubChem CID 86292478) has the molecular formula C10H11F3N4O2 and a molecular weight of 276.22 g/mol. Its IUPAC name is 1-ethyl-3,7-dimethyl-8-(trifluoromethyl)purine-2,6-dione.
| Compound Name | 1-ethyl-3,7-dimethyl-8-(trifluoromethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 86292478 |
| Molecular Formula | C10H11F3N4O2 |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 1-ethyl-3,7-dimethyl-8-(trifluoromethyl)purine-2,6-dione |
| SMILES | CCn1c(=O)c2c(nc(C(F)(F)F)n2C)n(C)c1=O |
| InChI | InChI=1S/C10H11F3N4O2/c1-4-17-7(18)5-6(16(3)9(17)19)14-8(15(5)2)10(11,12)13/h4H2,1-3H3 |
| InChIKey | ORZYOAJCYYORLD-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |