C26H25N7O10S2 — CID 10394586
N-[1,3-bis(cyclopropylmethyl)-7-methyl-2,6-dioxopurin-8-yl]-4-nitro-N-(4-nitrophenyl)sulfonylbenzenesulfonamide (PubChem CID 10394586) has the molecular formula C26H25N7O10S2 and a molecular weight of 659.66 g/mol. Its IUPAC name is N-[1,3-bis(cyclopropylmethyl)-7-methyl-2,6-dioxopurin-8-yl]-4-nitro-N-(4-nitrophenyl)sulfonylbenzenesulfonamide.
| Compound Name | N-[1,3-bis(cyclopropylmethyl)-7-methyl-2,6-dioxopurin-8-yl]-4-nitro-N-(4-nitrophenyl)sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 10394586 |
| Molecular Formula | C26H25N7O10S2 |
| Molecular Weight | 659.66 g/mol |
| Exact Mass | 659.11 |
| IUPAC Name | N-[1,3-bis(cyclopropylmethyl)-7-methyl-2,6-dioxopurin-8-yl]-4-nitro-N-(4-nitrophenyl)sulfonylbenzenesulfonamide |
| SMILES | Cn1c(N(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)S(=O)(=O)c2ccc([N+](=O)[O-])cc2)nc2c1c(=O)n(CC1CC1)c(=O)n2CC1CC1 |
| InChI | InChI=1S/C26H25N7O10S2/c1-28-22-23(29(14-16-2-3-16)26(35)30(24(22)34)15-17-4-5-17)27-25(28)33(44(40,41)20-10-6-18(7-11-20)31(36)37)45(42,43)21-12-8-19(9-13-21)32(38)39/h6-13,16-17H,2-5,14-15H2,1H3 |
| InChIKey | RJTVLTFABXLORW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 219.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.66 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|