C9H11ClN4O3 — CID 3048476
8-chloro-1-(2-hydroxyethyl)-3,7-dimethylpurine-2,6-dione (PubChem CID 3048476) has the molecular formula C9H11ClN4O3 and a molecular weight of 258.66 g/mol. Its IUPAC name is 8-chloro-1-(2-hydroxyethyl)-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-chloro-1-(2-hydroxyethyl)-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 3048476 |
| Molecular Formula | C9H11ClN4O3 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 8-chloro-1-(2-hydroxyethyl)-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(Cl)nc2c1c(=O)n(CCO)c(=O)n2C |
| InChI | InChI=1S/C9H11ClN4O3/c1-12-5-6(11-8(12)10)13(2)9(17)14(3-4-15)7(5)16/h15H,3-4H2,1-2H3 |
| InChIKey | LEBJETSSWRZCRZ-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |