C16H19ClN4O2 — CID 57498873
8-chloro-3-methyl-7-(3-methylbut-2-enyl)-1-pent-4-ynylpurine-2,6-dione (PubChem CID 57498873) has the molecular formula C16H19ClN4O2 and a molecular weight of 334.81 g/mol. Its IUPAC name is 8-chloro-3-methyl-7-(3-methylbut-2-enyl)-1-pent-4-ynylpurine-2,6-dione.
| Compound Name | 8-chloro-3-methyl-7-(3-methylbut-2-enyl)-1-pent-4-ynylpurine-2,6-dione |
|---|---|
| PubChem CID | 57498873 |
| Molecular Formula | C16H19ClN4O2 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 8-chloro-3-methyl-7-(3-methylbut-2-enyl)-1-pent-4-ynylpurine-2,6-dione |
| SMILES | C#CCCCn1c(=O)c2c(nc(Cl)n2CC=C(C)C)n(C)c1=O |
| InChI | InChI=1S/C16H19ClN4O2/c1-5-6-7-9-21-14(22)12-13(19(4)16(21)23)18-15(17)20(12)10-8-11(2)3/h1,8H,6-7,9-10H2,2-4H3 |
| InChIKey | MYJGVLVOHKJQFF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|