C16H21N5O4 — CID 10066267
7-methyl-1,3-bis(3-methylbut-2-enyl)-8-nitropurine-2,6-dione (PubChem CID 10066267) has the molecular formula C16H21N5O4 and a molecular weight of 347.38 g/mol. Its IUPAC name is 7-methyl-1,3-bis(3-methylbut-2-enyl)-8-nitropurine-2,6-dione.
| Compound Name | 7-methyl-1,3-bis(3-methylbut-2-enyl)-8-nitropurine-2,6-dione |
|---|---|
| PubChem CID | 10066267 |
| Molecular Formula | C16H21N5O4 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 7-methyl-1,3-bis(3-methylbut-2-enyl)-8-nitropurine-2,6-dione |
| SMILES | CC(C)=CCn1c(=O)c2c(nc([N+](=O)[O-])n2C)n(CC=C(C)C)c1=O |
| InChI | InChI=1S/C16H21N5O4/c1-10(2)6-8-19-13-12(18(5)15(17-13)21(24)25)14(22)20(16(19)23)9-7-11(3)4/h6-7H,8-9H2,1-5H3 |
| InChIKey | XCKMCKOUBLCKRI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 104.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|