C19H20N4O4 — CID 6447879
(E)-3-[4-[1-methyl-3-(2-methylpropyl)-2,6-dioxo-7H-purin-8-yl]phenyl]prop-2-enoic acid (PubChem CID 6447879) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is (E)-3-[4-[1-methyl-3-(2-methylpropyl)-2,6-dioxo-7H-purin-8-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[1-methyl-3-(2-methylpropyl)-2,6-dioxo-7H-purin-8-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 6447879 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (E)-3-[4-[1-methyl-3-(2-methylpropyl)-2,6-dioxo-7H-purin-8-yl]phenyl]prop-2-enoic acid |
| SMILES | CC(C)Cn1c(=O)n(C)c(=O)c2[nH]c(-c3ccc(/C=C/C(=O)O)cc3)nc21 |
| InChI | InChI=1S/C19H20N4O4/c1-11(2)10-23-17-15(18(26)22(3)19(23)27)20-16(21-17)13-7-4-12(5-8-13)6-9-14(24)25/h4-9,11H,10H2,1-3H3,(H,20,21)(H,24,25)/b9-6+ |
| InChIKey | DHINCXPFWWHQGY-RMKNXTFCSA-N |
| XLogP | 1.84 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|