C15H16N6O2 — CID 21285790
1,3-dimethyl-8-[4-[(methyldiazenyl)methyl]phenyl]-7H-purine-2,6-dione (PubChem CID 21285790) has the molecular formula C15H16N6O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is 1,3-dimethyl-8-[4-[(methyldiazenyl)methyl]phenyl]-7H-purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-[4-[(methyldiazenyl)methyl]phenyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 21285790 |
| Molecular Formula | C15H16N6O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1,3-dimethyl-8-[4-[(methyldiazenyl)methyl]phenyl]-7H-purine-2,6-dione |
| SMILES | C/N=N/Cc1ccc(-c2nc3c([nH]2)c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C15H16N6O2/c1-16-17-8-9-4-6-10(7-5-9)12-18-11-13(19-12)20(2)15(23)21(3)14(11)22/h4-7H,8H2,1-3H3,(H,18,19)/b17-16+ |
| InChIKey | UHHIXLZPPUORIB-WUKNDPDISA-N |
| XLogP | 1.21 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|