C9H13ClN6O3S — CID 3076157
2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]acetohydrazide;hydrochloride (PubChem CID 3076157) has the molecular formula C9H13ClN6O3S and a molecular weight of 320.76 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]acetohydrazide;hydrochloride.
| Compound Name | 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]acetohydrazide;hydrochloride |
|---|---|
| PubChem CID | 3076157 |
| Molecular Formula | C9H13ClN6O3S |
| Molecular Weight | 320.76 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-[(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)sulfanyl]acetohydrazide;hydrochloride |
| SMILES | Cl.Cn1c(=O)c2[nH]c(SCC(=O)NN)nc2n(C)c1=O |
| InChI | InChI=1S/C9H12N6O3S.ClH/c1-14-6-5(7(17)15(2)9(14)18)11-8(12-6)19-3-4(16)13-10;/h3,10H2,1-2H3,(H,11,12)(H,13,16);1H |
| InChIKey | FLCCWXVXNORWQS-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.76 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|