C16H17N5O4S — CID 155514100
8-[(2E)-2-hydroxyimino-2-(4-methoxyphenyl)ethyl]sulfanyl-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 155514100) has the molecular formula C16H17N5O4S and a molecular weight of 375.41 g/mol. Its IUPAC name is 8-[(2E)-2-hydroxyimino-2-(4-methoxyphenyl)ethyl]sulfanyl-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-[(2E)-2-hydroxyimino-2-(4-methoxyphenyl)ethyl]sulfanyl-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 155514100 |
| Molecular Formula | C16H17N5O4S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 8-[(2E)-2-hydroxyimino-2-(4-methoxyphenyl)ethyl]sulfanyl-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | COc1ccc(/C(CSc2nc3c([nH]2)c(=O)n(C)c(=O)n3C)=N\O)cc1 |
| InChI | InChI=1S/C16H17N5O4S/c1-20-13-12(14(22)21(2)16(20)23)17-15(18-13)26-8-11(19-24)9-4-6-10(25-3)7-5-9/h4-7,24H,8H2,1-3H3,(H,17,18)/b19-11- |
| InChIKey | WPMCLNWINMKXCA-ODLFYWEKSA-N |
| XLogP | 0.94 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|