C11H16N4O4S — CID 155185564
8-(4,4-dihydroxybutylsulfanyl)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 155185564) has the molecular formula C11H16N4O4S and a molecular weight of 300.34 g/mol. Its IUPAC name is 8-(4,4-dihydroxybutylsulfanyl)-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-(4,4-dihydroxybutylsulfanyl)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 155185564 |
| Molecular Formula | C11H16N4O4S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 8-(4,4-dihydroxybutylsulfanyl)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(SCCCC(O)O)nc2n(C)c1=O |
| InChI | InChI=1S/C11H16N4O4S/c1-14-8-7(9(18)15(2)11(14)19)12-10(13-8)20-5-3-4-6(16)17/h6,16-17H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | MVXPSOHZRPVFEV-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|