C10H15N5O3 — CID 6928527
8-[[(2S)-2-hydroxypropyl]amino]-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 6928527) has the molecular formula C10H15N5O3 and a molecular weight of 253.26 g/mol. Its IUPAC name is 8-[[(2S)-2-hydroxypropyl]amino]-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-[[(2S)-2-hydroxypropyl]amino]-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 6928527 |
| Molecular Formula | C10H15N5O3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 8-[[(2S)-2-hydroxypropyl]amino]-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | C[C@H](O)CNc1nc2c([nH]1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C10H15N5O3/c1-5(16)4-11-9-12-6-7(13-9)14(2)10(18)15(3)8(6)17/h5,16H,4H2,1-3H3,(H2,11,12,13)/t5-/m0/s1 |
| InChIKey | CYEDVASDKZGDSY-YFKPBYRVSA-N |
| XLogP | -1.25 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |