C12H15N5O2 — CID 106231256
1,3-dimethyl-8-(pent-1-yn-3-ylamino)-7H-purine-2,6-dione (PubChem CID 106231256) has the molecular formula C12H15N5O2 and a molecular weight of 261.28 g/mol. Its IUPAC name is 1,3-dimethyl-8-(pent-1-yn-3-ylamino)-7H-purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-(pent-1-yn-3-ylamino)-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 106231256 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 1,3-dimethyl-8-(pent-1-yn-3-ylamino)-7H-purine-2,6-dione |
| SMILES | C#CC(CC)Nc1nc2c([nH]1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C12H15N5O2/c1-5-7(6-2)13-11-14-8-9(15-11)16(3)12(19)17(4)10(8)18/h1,7H,6H2,2-4H3,(H2,13,14,15) |
| InChIKey | DAVOTUSFTCQJCY-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|