C10H15N5O2 — CID 11776306
8-(1-aminopropyl)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 11776306) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 8-(1-aminopropyl)-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-(1-aminopropyl)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 11776306 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 8-(1-aminopropyl)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | CCC(N)c1nc2c([nH]1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C10H15N5O2/c1-4-5(11)7-12-6-8(13-7)14(2)10(17)15(3)9(6)16/h5H,4,11H2,1-3H3,(H,12,13) |
| InChIKey | OEJCVDVCTKNMSI-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |